cas: 342595-74-8 — see every product listed under this CAS number, including other names
4-(Pyrrolidin-1-yl)-5-(p-tolyl)thieno[2,3-d]pyrimidine, 98% (CAS 342595-74-8) is a chemical reagent available from Chemat. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 250mg. Offered by: BLDpharm, Chemat.
| brand | BLDpharm |
|---|---|
| catalog number | BD01687137-10mg |
| cas | 342595-74-8 |
| size | 10mg |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| BLDpharm | 10mg | 569.82 Pln | |
| BLDpharm | 25mg | 1025.22 Pln | |
| BLDpharm | 50mg | 1686.10 Pln | |
| BLDpharm | 100mg | 2813.48 Pln | |
| BLDpharm | 250mg | 5284.83 Pln | |
| Chemat | 10mg | 419.60 Pln | |
| Chemat | 25mg | 741.20 Pln | |
| Chemat | 50mg | 1211.60 Pln | |
| Chemat | 100mg | 2018.00 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
5-(4-methylphenyl)-4-pyrrolidin-1-ylthieno[2,3-d]pyrimidine (CAS 342595-74-8) is a chemical compound with the molecular formula C17H17N3S and a molecular weight of 295.4 g/mol. IUPAC name: 5-(4-methylphenyl)-4-pyrrolidin-1-ylthieno[2,3-d]pyrimidine. InChIKey: VOAWQTDHSSKEKA-UHFFFAOYSA-N.
| Molecular formula | C17H17N3S |
|---|---|
| Molecular weight | 295.4 g/mol |
| IUPAC name | 5-(4-methylphenyl)-4-pyrrolidin-1-ylthieno[2,3-d]pyrimidine |
| InChIKey | VOAWQTDHSSKEKA-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)C2=CSC3=NC=NC(=C23)N4CCCC4 |
Computed by PubChem (NCBI)