Products 1189866-35-0
CAS 1189866-35-0 appears in our catalog under these names: Quetiapine EP Impurity B-d8, N-Des(2-(2-hydroxyethoxy)ethyl) Quetiapine-d8, >95% (HPLC), Norquetiapine-d8. Offered by: Chemat Brand, TRC, MedChemExpress. Available pack sizes: on request, 10mg, 1mg, 1 mg.
6-(2,2,3,3,5,5,6,6-octadeuteriopiperazin-1-yl)benzo[b][1,4]benzothiazepine (CAS 1189866-35-0) is a chemical compound with the molecular formula C17H17N3S and a molecular weight of 303.5 g/mol. IUPAC name: 6-(2,2,3,3,5,5,6,6-octadeuteriopiperazin-1-yl)benzo[b][1,4]benzothiazepine. InChIKey: JLOAJISUHPIQOX-PMCMNDOISA-N.
| Molecular formula | C17H17N3S |
|---|---|
| Molecular weight | 303.5 g/mol |
| IUPAC name | 6-(2,2,3,3,5,5,6,6-octadeuteriopiperazin-1-yl)benzo[b][1,4]benzothiazepine |
| InChIKey | JLOAJISUHPIQOX-PMCMNDOISA-N |
| SMILES | [2H]C1(C(N(C(C(N1)([2H])[2H])([2H])[2H])C2=NC3=CC=CC=C3SC4=CC=CC=C42)([2H])[2H])[2H] |
Computed by PubChem (NCBI)