CAS 84382-17-2 is the registry number for 5-Benzyl-4-(3,4-dimethylphenyl)-4H-1,2,4-triazole--3-thiol, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3-benzyl-4-(3,4-dimethylphenyl)-1H-1,2,4-triazole-5-thione (CAS 84382-17-2) is a chemical compound with the molecular formula C17H17N3S and a molecular weight of 295.4 g/mol. IUPAC name: 3-benzyl-4-(3,4-dimethylphenyl)-1H-1,2,4-triazole-5-thione. InChIKey: DVANCPCATXKJQI-UHFFFAOYSA-N.
| Molecular formula | C17H17N3S |
|---|---|
| Molecular weight | 295.4 g/mol |
| IUPAC name | 3-benzyl-4-(3,4-dimethylphenyl)-1H-1,2,4-triazole-5-thione |
| InChIKey | DVANCPCATXKJQI-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)N2C(=NNC2=S)CC3=CC=CC=C3)C |
Computed by PubChem (NCBI)