cas: 235101-36-7 — see every product listed under this CAS number, including other names
4-(Trifluoromethoxy)benzo[d]thiazol-2-amine, 95%+, 95%+ (CAS 235101-36-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch113NH0-100mg |
| cas | 235101-36-7 |
| size | 100mg |
| availability | 1g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 846.80 Pln | |
| Chemat | 250mg | 1648.40 Pln | |
| Chemat | 1g | 4197.20 Pln |
| purity | 95%+ |
|---|---|
| delivery time | 3 weeks |
4-(trifluoromethoxy)-1,3-benzothiazol-2-amine (CAS 235101-36-7) is a chemical compound with the molecular formula C8H5F3N2OS and a molecular weight of 234.20 g/mol. IUPAC name: 4-(trifluoromethoxy)-1,3-benzothiazol-2-amine. InChIKey: YSURRMGJTOKALN-UHFFFAOYSA-N.
| Molecular formula | C8H5F3N2OS |
|---|---|
| Molecular weight | 234.20 g/mol |
| IUPAC name | 4-(trifluoromethoxy)-1,3-benzothiazol-2-amine |
| InChIKey | YSURRMGJTOKALN-UHFFFAOYSA-N |
| SMILES | C1=CC(=C2C(=C1)SC(=N2)N)OC(F)(F)F |
Computed by PubChem (NCBI)