CAS 1628317-84-9 appears in our catalog under these names: 6-(2,2,2-Trifluoroethyl)thieno[2,3-d]pyrimidin-4(3h)-one, 95%, 6-(2,2,2-Trifluoroethyl)thieno[2,3-d]pyrimidin-4(1H)-one, 98%, 98%, 6-(2,2,2-Trifluoroethyl)thieno[2,3-d]pyrimidin-4(1H)-one, 99.34%, 6-(2,2,2-TRIFLUOROETHYL)THIENO[2,3-D]PYRIMIDIN-4(3H)-ONE, 98%. Offered by: Combi-blocks, Chemat, MedChemExpress, Fluorochem. Available pack sizes: 250mg, 1g, 100mg, 1 g, 50 mg, 100 mg, 500 mg, 250 mg.
6-(2,2,2-trifluoroethyl)-3H-thieno[2,3-d]pyrimidin-4-one (CAS 1628317-84-9) is a chemical compound with the molecular formula C8H5F3N2OS and a molecular weight of 234.20 g/mol. IUPAC name: 6-(2,2,2-trifluoroethyl)-3H-thieno[2,3-d]pyrimidin-4-one. InChIKey: MPAWLCWXJREENO-UHFFFAOYSA-N.
| Molecular formula | C8H5F3N2OS |
|---|---|
| Molecular weight | 234.20 g/mol |
| IUPAC name | 6-(2,2,2-trifluoroethyl)-3H-thieno[2,3-d]pyrimidin-4-one |
| InChIKey | MPAWLCWXJREENO-UHFFFAOYSA-N |
| SMILES | C1=C(SC2=C1C(=O)NC=N2)CC(F)(F)F |
Computed by PubChem (NCBI)