CAS 1822818-45-0 is the registry number for 2-Thiocyanato-6-trifluoromethoxy-phenylamine, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g, 5g.
[2-amino-3-(trifluoromethoxy)phenyl] thiocyanate (CAS 1822818-45-0) is a chemical compound with the molecular formula C8H5F3N2OS and a molecular weight of 234.20 g/mol. IUPAC name: [2-amino-3-(trifluoromethoxy)phenyl] thiocyanate. InChIKey: RIBXAKIGIHITMF-UHFFFAOYSA-N.
| Molecular formula | C8H5F3N2OS |
|---|---|
| Molecular weight | 234.20 g/mol |
| IUPAC name | [2-amino-3-(trifluoromethoxy)phenyl] thiocyanate |
| InChIKey | RIBXAKIGIHITMF-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)SC#N)N)OC(F)(F)F |
Computed by PubChem (NCBI)