cas: 175277-18-6 — see every product listed under this CAS number, including other names
4-(Trifluoromethoxy)benzohydrazide, 97%, 97% (CAS 175277-18-6) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g, 100g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1131SC-1g |
| cas | 175277-18-6 |
| size | 1g |
| availability | 400g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 107.60 Pln | |
| Chemat | 5g | 227.60 Pln | |
| Chemat | 25g | 674.00 Pln | |
| Chemat | 100g | 1763.60 Pln | |
| Chemat | 10g | 386.00 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
4-(trifluoromethoxy)benzohydrazide (CAS 175277-18-6) is a chemical compound with the molecular formula C8H7F3N2O2 and a molecular weight of 220.15 g/mol. IUPAC name: 4-(trifluoromethoxy)benzohydrazide. InChIKey: QWYPNGTZNFACCP-UHFFFAOYSA-N.
| Molecular formula | C8H7F3N2O2 |
|---|---|
| Molecular weight | 220.15 g/mol |
| IUPAC name | 4-(trifluoromethoxy)benzohydrazide |
| InChIKey | QWYPNGTZNFACCP-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(=O)NN)OC(F)(F)F |
Computed by PubChem (NCBI)