CAS 175277-18-6 appears in our catalog under these names: 4-(Trifluoromethoxy)benzoic acid hydrazide, 97%, 4–Trifluoromethoxybenzhydrazide, 4-(Trifluoromethoxy)benzohydrazide 98%, 4-(Trifluoromethoxy)benzohydrazide, 97%, 97%, 4-(Trifluoromethoxy)benzoic acid hydrazide. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 25g, 5g, 100g, 1g, 10g, 40g.
4-(trifluoromethoxy)benzohydrazide (CAS 175277-18-6) is a chemical compound with the molecular formula C8H7F3N2O2 and a molecular weight of 220.15 g/mol. IUPAC name: 4-(trifluoromethoxy)benzohydrazide. InChIKey: QWYPNGTZNFACCP-UHFFFAOYSA-N.
| Molecular formula | C8H7F3N2O2 |
|---|---|
| Molecular weight | 220.15 g/mol |
| IUPAC name | 4-(trifluoromethoxy)benzohydrazide |
| InChIKey | QWYPNGTZNFACCP-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(=O)NN)OC(F)(F)F |
Computed by PubChem (NCBI)