CAS 1087788-75-7 appears in our catalog under these names: 2,2,2-Trifluoroethyl n-(pyridin-2-yl)carbamate, 95%, 2,2,2-Trifluoroethyl N-(pyridin-2-yl)carbamate. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg, 0,5g.
2,2,2-trifluoroethyl N-pyridin-2-ylcarbamate (CAS 1087788-75-7) is a chemical compound with the molecular formula C8H7F3N2O2 and a molecular weight of 220.15 g/mol. IUPAC name: 2,2,2-trifluoroethyl N-pyridin-2-ylcarbamate. InChIKey: FCBOWXGAOKPCQY-UHFFFAOYSA-N.
| Molecular formula | C8H7F3N2O2 |
|---|---|
| Molecular weight | 220.15 g/mol |
| IUPAC name | 2,2,2-trifluoroethyl N-pyridin-2-ylcarbamate |
| InChIKey | FCBOWXGAOKPCQY-UHFFFAOYSA-N |
| SMILES | C1=CC=NC(=C1)NC(=O)OCC(F)(F)F |
Computed by PubChem (NCBI)