cas: 175277-18-6 — see every product listed under this CAS number, including other names
4-(Trifluoromethoxy)benzoic acid hydrazide (CAS 175277-18-6) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g, 40g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F007543-1G |
| cas | 175277-18-6 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 200.99 Pln | |
| Fluorochem | 5g | 549.82 Pln | |
| Fluorochem | 25g | 1549.47 Pln | |
| Fluorochem | 40g | 1913.93 Pln |
| delivery time | 1-2 weeks |
|---|
4-(trifluoromethoxy)benzohydrazide (CAS 175277-18-6) is a chemical compound with the molecular formula C8H7F3N2O2 and a molecular weight of 220.15 g/mol. IUPAC name: 4-(trifluoromethoxy)benzohydrazide. InChIKey: QWYPNGTZNFACCP-UHFFFAOYSA-N.
| Molecular formula | C8H7F3N2O2 |
|---|---|
| Molecular weight | 220.15 g/mol |
| IUPAC name | 4-(trifluoromethoxy)benzohydrazide |
| InChIKey | QWYPNGTZNFACCP-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(=O)NN)OC(F)(F)F |
Computed by PubChem (NCBI)