cas: 1260676-79-6 — see every product listed under this CAS number, including other names
4-(Trifluoromethyl)pyrimidine-5-carbonitrile, 98% (CAS 1260676-79-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 2g, 5g. Offered by: Chemat, Fluorochem.
| brand | Chemat |
|---|---|
| catalog number | Ch111R2H-100mg |
| cas | 1260676-79-6 |
| size | 100mg |
| availability | 4g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 342.80 Pln | |
| Chemat | 250mg | 482.00 Pln | |
| Chemat | 1g | 1120.40 Pln | |
| Fluorochem | 100mg | 325.94 Pln | |
| Fluorochem | 250mg | 445.69 Pln | |
| Fluorochem | 1g | 1023.62 Pln | |
| Fluorochem | 2g | 1606.74 Pln | |
| Fluorochem | 5g | 3855.95 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
4-(trifluoromethyl)pyrimidine-5-carbonitrile (CAS 1260676-79-6) is a chemical compound with the molecular formula C6H2F3N3 and a molecular weight of 173.10 g/mol. IUPAC name: 4-(trifluoromethyl)pyrimidine-5-carbonitrile. InChIKey: LNBMWLBOFNHPJJ-UHFFFAOYSA-N.
| Molecular formula | C6H2F3N3 |
|---|---|
| Molecular weight | 173.10 g/mol |
| IUPAC name | 4-(trifluoromethyl)pyrimidine-5-carbonitrile |
| InChIKey | LNBMWLBOFNHPJJ-UHFFFAOYSA-N |
| SMILES | C1=C(C(=NC=N1)C(F)(F)F)C#N |
Computed by PubChem (NCBI)