cas: 2103-91-5 — see every product listed under this CAS number, including other names
4-(p-Tolyl)thiazol-2-amine, 98%, 98% (CAS 2103-91-5) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 50g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch113KOO-250mg |
| cas | 2103-91-5 |
| size | 250mg |
| availability | 150g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 88.40 Pln | |
| Chemat | 1g | 93.20 Pln | |
| Chemat | 5g | 155.60 Pln | |
| Chemat | 10g | 246.80 Pln | |
| Chemat | 25g | 496.40 Pln | |
| Chemat | 50g | 923.60 Pln | |
| Chemat | 100g | 1744.40 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
4-(4-methylphenyl)-1,3-thiazol-2-amine (CAS 2103-91-5) is a chemical compound with the molecular formula C10H10N2S and a molecular weight of 190.27 g/mol. IUPAC name: 4-(4-methylphenyl)-1,3-thiazol-2-amine. InChIKey: ARLHWYFAPHJCJT-UHFFFAOYSA-N.
| Molecular formula | C10H10N2S |
|---|---|
| Molecular weight | 190.27 g/mol |
| IUPAC name | 4-(4-methylphenyl)-1,3-thiazol-2-amine |
| InChIKey | ARLHWYFAPHJCJT-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)C2=CSC(=N2)N |
Computed by PubChem (NCBI)