cas: 99985-67-8 — see every product listed under this CAS number, including other names
4-(tert-Butoxy)benzamide, 95+% (CAS 99985-67-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 5g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A371689-100mg |
| cas | 99985-67-8 |
| size | 100mg |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 100mg | 825.16 Pln | |
| AmBeed | 5g | 8109.85 Pln |
| purity | 95+% |
|---|---|
| delivery time | To be confirmed by Chemat |
4-[(2-methylpropan-2-yl)oxy]benzamide (CAS 99985-67-8) is a chemical compound with the molecular formula C11H15NO2 and a molecular weight of 193.24 g/mol. IUPAC name: 4-[(2-methylpropan-2-yl)oxy]benzamide. InChIKey: SWWGCYPSKPHPKQ-UHFFFAOYSA-N.
| Molecular formula | C11H15NO2 |
|---|---|
| Molecular weight | 193.24 g/mol |
| IUPAC name | 4-[(2-methylpropan-2-yl)oxy]benzamide |
| InChIKey | SWWGCYPSKPHPKQ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC1=CC=C(C=C1)C(=O)N |
Computed by PubChem (NCBI)