4-(tert-Butyl)-2-chloroaniline, 98%
cas: 42265-67-8 — see every product listed under this CAS number, including other names
4-(tert-Butyl)-2-chloroaniline, 98% (CAS 42265-67-8) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g, 100mg, 250mg, 50g. Offered by: Fluorochem, Chemat.
| brand | Fluorochem |
|---|---|
| catalog number | F238866-1G |
| cas | 42265-67-8 |
| size | 1g |
| availability | In Stock Germany |
Documents:
Safety Data Sheet (MSDS)
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 169.75 Pln | |
| Fluorochem | 5g | 362.39 Pln | |
| Fluorochem | 10g | 544.62 Pln | |
| Fluorochem | 25g | 1023.62 Pln | |
| Fluorochem | 100g | 2986.47 Pln | |
| Chemat | 100mg | 83.60 Pln | |
| Chemat | 250mg | 88.40 Pln | |
| Chemat | 1g | 98.00 Pln | |
| Chemat | 5g | 189.20 Pln | |
| Chemat | 10g | 309.20 Pln | |
| Chemat | 25g | 587.60 Pln | |
| Chemat | 50g | 1062.80 Pln | |
| Chemat | 100g | 1922.00 Pln | |
| Chemat | 250g | 3851.60 Pln |
properties
| purity | 98% |
|---|---|
| dual use | No |
| currency | EUR |
| delivery time | 5-10 days |
| category | Odczynniki chemiczne |
4-tert-butyl-2-chloroaniline (CAS 42265-67-8) is a chemical compound with the molecular formula C10H14ClN and a molecular weight of 183.68 g/mol. IUPAC name: 4-tert-butyl-2-chloroaniline. InChIKey: MFEZEFHCSBXPPO-UHFFFAOYSA-N.
| Molecular formula | C10H14ClN |
|---|---|
| Molecular weight | 183.68 g/mol |
| IUPAC name | 4-tert-butyl-2-chloroaniline |
| InChIKey | MFEZEFHCSBXPPO-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC(=C(C=C1)N)Cl |
Computed by PubChem (NCBI)