cas: 159191-56-7 — see every product listed under this CAS number, including other names
4-(tert-Butyldimethylsiloxy)phenyl boronic acid 97% (CAS 159191-56-7) is a chemical reagent available from Chemat. Available pack sizes: 500g, 250mg, 1g, 5g, 25g, 100g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A393193-500g |
| cas | 159191-56-7 |
| size | 500g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 500g | 6311.12 Pln | |
| Ambeed | 250mg | 120.06 Pln | |
| Ambeed | 1g | 131.19 Pln | |
| Ambeed | 5g | 275.81 Pln | |
| Ambeed | 25g | 464.94 Pln | |
| Ambeed | 100g | 1633.06 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A393193 |
[4-[tert-butyl(dimethyl)silyl]oxyphenyl]boronic acid (CAS 159191-56-7) is a chemical compound with the molecular formula C12H21BO3Si and a molecular weight of 252.19 g/mol. IUPAC name: [4-[tert-butyl(dimethyl)silyl]oxyphenyl]boronic acid. InChIKey: NVHHEADQQACSCJ-UHFFFAOYSA-N.
| Molecular formula | C12H21BO3Si |
|---|---|
| Molecular weight | 252.19 g/mol |
| IUPAC name | [4-[tert-butyl(dimethyl)silyl]oxyphenyl]boronic acid |
| InChIKey | NVHHEADQQACSCJ-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)O[Si](C)(C)C(C)(C)C)(O)O |
Computed by PubChem (NCBI)