CAS 929277-63-4 appears in our catalog under these names: 2-(tert-Butyldimethylsilyloxy)phenylboronic acid, 95-<97%, 2-(tert-Butyldimethylsilyloxy)phenylboronic acid, ≥97-<99%, (2–((tert–Butyldimethylsilyl)oxy)phenyl)boronic acid, (2-((tert-Butyldimethylsilyl)oxy)phenyl)boronic acid 98%, (2-((tert-Butyldimethylsilyl)oxy)phenyl)boronic acid, 98%, 98%. Offered by: Hoffman Fine Chemicals, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 10g, 25g, 50g, 100g, 200g, 300g, 250mg, 100mg.
[2-[tert-butyl(dimethyl)silyl]oxyphenyl]boronic acid (CAS 929277-63-4) is a chemical compound with the molecular formula C12H21BO3Si and a molecular weight of 252.19 g/mol. IUPAC name: [2-[tert-butyl(dimethyl)silyl]oxyphenyl]boronic acid. InChIKey: VPEQFGRLHBVFKH-UHFFFAOYSA-N.
| Molecular formula | C12H21BO3Si |
|---|---|
| Molecular weight | 252.19 g/mol |
| IUPAC name | [2-[tert-butyl(dimethyl)silyl]oxyphenyl]boronic acid |
| InChIKey | VPEQFGRLHBVFKH-UHFFFAOYSA-N |
| SMILES | B(C1=CC=CC=C1O[Si](C)(C)C(C)(C)C)(O)O |
Computed by PubChem (NCBI)