CAS 261621-12-9 appears in our catalog under these names: 3-(T-Butyldimethylsilyloxy)phenylboronic acid, 97%, 3-(tert-Butyldimethylsiloxy)benzeneboronic acid, tech. 90% , 3-(tert-Butyldimethylsilyloxy)phenylboronic acid, 96+%, 3-(tert-Butyldimethylsilyloxy)phenylboronic Acid (contains varying amounts of Anhydride), (3-((tert-Butyldimethylsilyl)oxy)phenyl)boronic acid 98%. Offered by: Combi-blocks, Thermo Scientific (Alfa Aesar), Thermo Scientific (Acros), TCI, Ambeed. Available pack sizes: 1g, 25g, 5g, 100g, 100mg, 250mg.
[3-[tert-butyl(dimethyl)silyl]oxyphenyl]boronic acid (CAS 261621-12-9) is a chemical compound with the molecular formula C12H21BO3Si and a molecular weight of 252.19 g/mol. IUPAC name: [3-[tert-butyl(dimethyl)silyl]oxyphenyl]boronic acid. InChIKey: RDQWADDNQONTLB-UHFFFAOYSA-N.
| Molecular formula | C12H21BO3Si |
|---|---|
| Molecular weight | 252.19 g/mol |
| IUPAC name | [3-[tert-butyl(dimethyl)silyl]oxyphenyl]boronic acid |
| InChIKey | RDQWADDNQONTLB-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC=C1)O[Si](C)(C)C(C)(C)C)(O)O |
Computed by PubChem (NCBI)