4-(tert-butyl)-3-nitrobenzoic acid, 98%
cas: 59719-78-7 — see every product listed under this CAS number, including other names
4-(tert-butyl)-3-nitrobenzoic acid, 98% (CAS 59719-78-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 2.5g, 5g, 10g. Offered by: Fluorochem, Chemat.
| brand | Fluorochem |
|---|---|
| catalog number | F512069-100MG |
| cas | 59719-78-7 |
| size | 100mg |
| availability | In Stock China |
Documents:
Safety Data Sheet (MSDS)
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 393.63 Pln | |
| Fluorochem | 250mg | 497.76 Pln | |
| Fluorochem | 500mg | 883.04 Pln | |
| Fluorochem | 1g | 1205.84 Pln | |
| Fluorochem | 2.5g | 2460.61 Pln | |
| Fluorochem | 5g | 3392.57 Pln | |
| Fluorochem | 10g | 5423.11 Pln | |
| Chemat | 100mg | 242.00 Pln | |
| Chemat | 250mg | 328.40 Pln | |
| Chemat | 1g | 784.40 Pln | |
| Chemat | 5g | 2210.00 Pln | |
| Chemat | 10g | 3371.60 Pln |
properties
| purity | 98% |
|---|---|
| dual use | No |
| currency | EUR |
| delivery time | 2-3 weeks |
| category | Odczynniki chemiczne |
4-tert-butyl-3-nitrobenzoic acid (CAS 59719-78-7) is a chemical compound with the molecular formula C11H13NO4 and a molecular weight of 223.22 g/mol. IUPAC name: 4-tert-butyl-3-nitrobenzoic acid. InChIKey: QIHHYQWNYKOHEV-UHFFFAOYSA-N.
| Molecular formula | C11H13NO4 |
|---|---|
| Molecular weight | 223.22 g/mol |
| IUPAC name | 4-tert-butyl-3-nitrobenzoic acid |
| InChIKey | QIHHYQWNYKOHEV-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=C(C=C(C=C1)C(=O)O)[N+](=O)[O-] |
Computed by PubChem (NCBI)