Products 59719-78-7
CAS 59719-78-7 appears in our catalog under these names: 4-tert-Butyl-3-nitrobenzoic acid, 97%, 4-tert-butyl-3-nitrobenzoic acid, 4-(tert-Butyl)-3-nitrobenzoic acid, 98%, 98%, 4-(tert-butyl)-3-nitrobenzoic acid, 98%. Offered by: Combi-blocks, Biosynth, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 250mg, 10g, 2,5g, 100mg, 500mg, 2.5g.
4-tert-butyl-3-nitrobenzoic acid (CAS 59719-78-7) is a chemical compound with the molecular formula C11H13NO4 and a molecular weight of 223.22 g/mol. IUPAC name: 4-tert-butyl-3-nitrobenzoic acid. InChIKey: QIHHYQWNYKOHEV-UHFFFAOYSA-N.
| Molecular formula | C11H13NO4 |
|---|---|
| Molecular weight | 223.22 g/mol |
| IUPAC name | 4-tert-butyl-3-nitrobenzoic acid |
| InChIKey | QIHHYQWNYKOHEV-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=C(C=C(C=C1)C(=O)O)[N+](=O)[O-] |
Computed by PubChem (NCBI)