cas: 90525-37-4 — see every product listed under this CAS number, including other names
4-(trans-4-Heptylcyclohexyl)phenol, 98%, 98% (CAS 90525-37-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g, 50g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114UXI-100mg |
| cas | 90525-37-4 |
| size | 100mg |
| availability | 60g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 98.00 Pln | |
| Chemat | 250mg | 122.00 Pln | |
| Chemat | 1g | 174.80 Pln | |
| Chemat | 5g | 318.80 Pln | |
| Chemat | 10g | 429.20 Pln | |
| Chemat | 25g | 630.80 Pln | |
| Chemat | 50g | 1096.40 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
4-(4-heptylcyclohexyl)phenol (CAS 90525-37-4) is a chemical compound with the molecular formula C19H30O and a molecular weight of 274.4 g/mol. IUPAC name: 4-(4-heptylcyclohexyl)phenol. InChIKey: LQNATOSZMJPGNE-UHFFFAOYSA-N.
| Molecular formula | C19H30O |
|---|---|
| Molecular weight | 274.4 g/mol |
| IUPAC name | 4-(4-heptylcyclohexyl)phenol |
| InChIKey | LQNATOSZMJPGNE-UHFFFAOYSA-N |
| SMILES | CCCCCCCC1CCC(CC1)C2=CC=C(C=C2)O |
Computed by PubChem (NCBI)