cas: 90525-37-4 — see every product listed under this CAS number, including other names
4-(Trans-4-heptylcyclohexyl)phenol 97% (CAS 90525-37-4) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g, 100g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A499009-1g |
| cas | 90525-37-4 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 203.50 Pln | |
| Ambeed | 5g | 459.38 Pln | |
| Ambeed | 25g | 921.06 Pln | |
| Ambeed | 100g | 2790.06 Pln |
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A499009 |
4-(4-heptylcyclohexyl)phenol (CAS 90525-37-4) is a chemical compound with the molecular formula C19H30O and a molecular weight of 274.4 g/mol. IUPAC name: 4-(4-heptylcyclohexyl)phenol. InChIKey: LQNATOSZMJPGNE-UHFFFAOYSA-N.
| Molecular formula | C19H30O |
|---|---|
| Molecular weight | 274.4 g/mol |
| IUPAC name | 4-(4-heptylcyclohexyl)phenol |
| InChIKey | LQNATOSZMJPGNE-UHFFFAOYSA-N |
| SMILES | CCCCCCCC1CCC(CC1)C2=CC=C(C=C2)O |
Computed by PubChem (NCBI)