cas: 154748-67-1 — see every product listed under this CAS number, including other names
4-[(1,2,4-Triazole-1-yl)methyl]phenylhydrazine HCl 98% (CAS 154748-67-1) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A367956-250mg |
| cas | 154748-67-1 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 331.44 Pln | |
| Ambeed | 1g | 698.56 Pln | |
| Ambeed | 5g | 1955.69 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A367956 |
[4-(1,2,4-triazol-1-ylmethyl)phenyl]hydrazine;hydrochloride (CAS 154748-67-1) is a chemical compound with the molecular formula C9H12ClN5 and a molecular weight of 225.68 g/mol. IUPAC name: [4-(1,2,4-triazol-1-ylmethyl)phenyl]hydrazine;hydrochloride. InChIKey: WTSGWKNUHMEHOH-UHFFFAOYSA-N.
| Molecular formula | C9H12ClN5 |
|---|---|
| Molecular weight | 225.68 g/mol |
| IUPAC name | [4-(1,2,4-triazol-1-ylmethyl)phenyl]hydrazine;hydrochloride |
| InChIKey | WTSGWKNUHMEHOH-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1CN2C=NC=N2)NN.Cl |
Computed by PubChem (NCBI)