CAS 49872-65-3 appears in our catalog under these names: N-(5-Chloro-2-methylphenyl)imidodicarbonimidic diamide, 95%, N-(5-Chloro-2-methylphenyl)imidodicarbonimidic diamide, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
2-(5-chloro-2-methylphenyl)-1-(diaminomethylidene)guanidine (CAS 49872-65-3) is a chemical compound with the molecular formula C9H12ClN5 and a molecular weight of 225.68 g/mol. IUPAC name: 2-(5-chloro-2-methylphenyl)-1-(diaminomethylidene)guanidine. InChIKey: SJPLIZPAHCNLFD-UHFFFAOYSA-N.
| Molecular formula | C9H12ClN5 |
|---|---|
| Molecular weight | 225.68 g/mol |
| IUPAC name | 2-(5-chloro-2-methylphenyl)-1-(diaminomethylidene)guanidine |
| InChIKey | SJPLIZPAHCNLFD-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)Cl)N=C(N)N=C(N)N |
Computed by PubChem (NCBI)