CAS 154748-67-1 appears in our catalog under these names: Rizatriptan Impurity 1, 1-[(4-Hydrazinophenyl)methyl]-1H-1,2,4-triazole hydrochloride, 98%, 4-[(1,2,4-Triazole-1-yl)methyl]phenylhydrazine HCl 98%, 1-[(4-Hydrazinophenyl)methyl]-1h-1,2,4-triazole hydrochloride, 98%, 98%, 1-[(4-Hydrazinophenyl)methyl]-1H-1,2,4-triazole hydrochloride, 95%. Offered by: Chemat Brand, Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: on request, 10g, 5g, 1g, 250mg, 100mg.
[4-(1,2,4-triazol-1-ylmethyl)phenyl]hydrazine;hydrochloride (CAS 154748-67-1) is a chemical compound with the molecular formula C9H12ClN5 and a molecular weight of 225.68 g/mol. IUPAC name: [4-(1,2,4-triazol-1-ylmethyl)phenyl]hydrazine;hydrochloride. InChIKey: WTSGWKNUHMEHOH-UHFFFAOYSA-N.
| Molecular formula | C9H12ClN5 |
|---|---|
| Molecular weight | 225.68 g/mol |
| IUPAC name | [4-(1,2,4-triazol-1-ylmethyl)phenyl]hydrazine;hydrochloride |
| InChIKey | WTSGWKNUHMEHOH-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1CN2C=NC=N2)NN.Cl |
Computed by PubChem (NCBI)