cas: 92952-81-3 — see every product listed under this CAS number, including other names
4-[(3-Hydroxypropyl)amino]-3-nitrophenol, 95% (CAS 92952-81-3) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g, 100g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F210800-1G |
| cas | 92952-81-3 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 102.07 Pln | |
| Fluorochem | 5g | 138.51 Pln | |
| Fluorochem | 25g | 393.63 Pln | |
| Fluorochem | 100g | 888.25 Pln | |
| Fluorochem | 10g | 216.61 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
4-(3-hydroxypropylamino)-3-nitrophenol (CAS 92952-81-3) is a chemical compound with the molecular formula C9H12N2O4 and a molecular weight of 212.20 g/mol. IUPAC name: 4-(3-hydroxypropylamino)-3-nitrophenol. InChIKey: VTXBLQLZQLHDIL-UHFFFAOYSA-N.
| Molecular formula | C9H12N2O4 |
|---|---|
| Molecular weight | 212.20 g/mol |
| IUPAC name | 4-(3-hydroxypropylamino)-3-nitrophenol |
| InChIKey | VTXBLQLZQLHDIL-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1O)[N+](=O)[O-])NCCCO |
Computed by PubChem (NCBI)