CAS 32064-65-6 appears in our catalog under these names: Benzylhydrazine oxalate, 95%, Benzylhydrazine oxalate, ≥96%, ≥96%. Offered by: Combi-blocks, Chemat. Available pack sizes: 5g, 1g.
Benzylhydrazine;oxalic acid (CAS 32064-65-6) is a chemical compound with the molecular formula C9H12N2O4 and a molecular weight of 212.20 g/mol. IUPAC name: benzylhydrazine;oxalic acid. InChIKey: RCHUSXHCJLZTEY-UHFFFAOYSA-N.
| Molecular formula | C9H12N2O4 |
|---|---|
| Molecular weight | 212.20 g/mol |
| IUPAC name | benzylhydrazine;oxalic acid |
| InChIKey | RCHUSXHCJLZTEY-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CNN.C(=O)(C(=O)O)O |
Computed by PubChem (NCBI)