CAS 37687-26-6 appears in our catalog under these names: Diethyl 1h-pyrazole-4,5-dicarboxylate, 95%, Diethyl 1h-pyrazole-3,4-dicarboxylate, 95%, Diethyl 1H-pyrazole-3,4-dicarboxylate, 97%, Diethyl 1H–pyrazole–3,4–dicarboxylate, diethyl 1H-pyrazole-3,4-dicarboxylate. Offered by: Combi-blocks, AmBeed, GLPBio, Biosynth, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 10g, 5g, 50mg.
Diethyl 1H-pyrazole-4,5-dicarboxylate (CAS 37687-26-6) is a chemical compound with the molecular formula C9H12N2O4 and a molecular weight of 212.20 g/mol. IUPAC name: diethyl 1H-pyrazole-4,5-dicarboxylate. InChIKey: VZKOLHTYHOVCKT-UHFFFAOYSA-N.
| Molecular formula | C9H12N2O4 |
|---|---|
| Molecular weight | 212.20 g/mol |
| IUPAC name | diethyl 1H-pyrazole-4,5-dicarboxylate |
| InChIKey | VZKOLHTYHOVCKT-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(NN=C1)C(=O)OCC |
Computed by PubChem (NCBI)