cas: 1285578-70-2 — see every product listed under this CAS number, including other names
4-[(4-Bromophenyl)amino]benzoic Acid, 95%, 95% (CAS 1285578-70-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch13M4AL-100mg |
| cas | 1285578-70-2 |
| size | 100mg |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 544.40 Pln | |
| Chemat | 250mg | 803.60 Pln | |
| Chemat | 1g | 1902.80 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
4-(4-bromoanilino)benzoic acid (CAS 1285578-70-2) is a chemical compound with the molecular formula C13H10BrNO2 and a molecular weight of 292.13 g/mol. IUPAC name: 4-(4-bromoanilino)benzoic acid. InChIKey: YDGQECFWLPULHI-UHFFFAOYSA-N.
| Molecular formula | C13H10BrNO2 |
|---|---|
| Molecular weight | 292.13 g/mol |
| IUPAC name | 4-(4-bromoanilino)benzoic acid |
| InChIKey | YDGQECFWLPULHI-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(=O)O)NC2=CC=C(C=C2)Br |
Computed by PubChem (NCBI)