CAS 1289215-35-5 is the registry number for Benzyl 4-bromopyridine-2-carboxylate, 98%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
Benzyl 4-bromopyridine-2-carboxylate (CAS 1289215-35-5) is a chemical compound with the molecular formula C13H10BrNO2 and a molecular weight of 292.13 g/mol. IUPAC name: benzyl 4-bromopyridine-2-carboxylate. InChIKey: VGRGCBVDPJPGLU-UHFFFAOYSA-N.
| Molecular formula | C13H10BrNO2 |
|---|---|
| Molecular weight | 292.13 g/mol |
| IUPAC name | benzyl 4-bromopyridine-2-carboxylate |
| InChIKey | VGRGCBVDPJPGLU-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC(=O)C2=NC=CC(=C2)Br |
Computed by PubChem (NCBI)