Products 50882-29-6
CAS 50882-29-6 appears in our catalog under these names: Phenyl n-(4-bromophenyl)carbamate, 95%, Phenyl (4-bromophenyl)carbamate, 95+%, Phenyl(4–bromophenyl)carbamate, Phenyl (4-bromophenyl)carbamate. Offered by: Combi-blocks, AmBeed, GLPBio, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 5g, 100mg.
Phenyl N-(4-bromophenyl)carbamate (CAS 50882-29-6) is a chemical compound with the molecular formula C13H10BrNO2 and a molecular weight of 292.13 g/mol. IUPAC name: phenyl N-(4-bromophenyl)carbamate. InChIKey: DFVROMJTBLOOGY-UHFFFAOYSA-N.
| Molecular formula | C13H10BrNO2 |
|---|---|
| Molecular weight | 292.13 g/mol |
| IUPAC name | phenyl N-(4-bromophenyl)carbamate |
| InChIKey | DFVROMJTBLOOGY-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)OC(=O)NC2=CC=C(C=C2)Br |
Computed by PubChem (NCBI)