cas: 473-27-8 — see every product listed under this CAS number, including other names
4-[(trifluoromethyl)sulfonyl]aniline, 95% (CAS 473-27-8) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F358342-250MG |
| cas | 473-27-8 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 159.34 Pln | |
| Fluorochem | 1g | 237.43 Pln | |
| Fluorochem | 5g | 784.12 Pln | |
| Fluorochem | 10g | 1507.82 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
4-(trifluoromethylsulfonyl)aniline (CAS 473-27-8) is a chemical compound with the molecular formula C7H6F3NO2S and a molecular weight of 225.19 g/mol. IUPAC name: 4-(trifluoromethylsulfonyl)aniline. InChIKey: GNVFCXUZQGCXPB-UHFFFAOYSA-N.
| Molecular formula | C7H6F3NO2S |
|---|---|
| Molecular weight | 225.19 g/mol |
| IUPAC name | 4-(trifluoromethylsulfonyl)aniline |
| InChIKey | GNVFCXUZQGCXPB-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1N)S(=O)(=O)C(F)(F)F |
Computed by PubChem (NCBI)