CAS 1499416-07-7 is the registry number for 2-(3,3,3-Trifluoropropyl)thiazole-4-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-(3,3,3-trifluoropropyl)-1,3-thiazole-4-carboxylic acid (CAS 1499416-07-7) is a chemical compound with the molecular formula C7H6F3NO2S and a molecular weight of 225.19 g/mol. IUPAC name: 2-(3,3,3-trifluoropropyl)-1,3-thiazole-4-carboxylic acid. InChIKey: JPATXLRBFGGXGD-UHFFFAOYSA-N.
| Molecular formula | C7H6F3NO2S |
|---|---|
| Molecular weight | 225.19 g/mol |
| IUPAC name | 2-(3,3,3-trifluoropropyl)-1,3-thiazole-4-carboxylic acid |
| InChIKey | JPATXLRBFGGXGD-UHFFFAOYSA-N |
| SMILES | C1=C(N=C(S1)CCC(F)(F)F)C(=O)O |
Computed by PubChem (NCBI)