Products 1499416-07-7

CAS 1499416-07-7 is the registry number for 2-(3,3,3-Trifluoropropyl)thiazole-4-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

2-(3,3,3-trifluoropropyl)-1,3-thiazole-4-carboxylic acid (CAS 1499416-07-7) is a chemical compound with the molecular formula C7H6F3NO2S and a molecular weight of 225.19 g/mol. IUPAC name: 2-(3,3,3-trifluoropropyl)-1,3-thiazole-4-carboxylic acid. InChIKey: JPATXLRBFGGXGD-UHFFFAOYSA-N.

Identity
Molecular formulaC7H6F3NO2S
Molecular weight225.19 g/mol
IUPAC name2-(3,3,3-trifluoropropyl)-1,3-thiazole-4-carboxylic acid
InChIKeyJPATXLRBFGGXGD-UHFFFAOYSA-N
SMILESC1=C(N=C(S1)CCC(F)(F)F)C(=O)O

Computed by PubChem (NCBI)