Products 2920304-30-7

CAS 2920304-30-7 is the registry number for 4-(3,3,3-Trifluoropropyl)thiazole-2-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

4-(3,3,3-trifluoropropyl)-1,3-thiazole-2-carboxylic acid (CAS 2920304-30-7) is a chemical compound with the molecular formula C7H6F3NO2S and a molecular weight of 225.19 g/mol. IUPAC name: 4-(3,3,3-trifluoropropyl)-1,3-thiazole-2-carboxylic acid. InChIKey: KTBCKZKGWCPOPH-UHFFFAOYSA-N.

Identity
Molecular formulaC7H6F3NO2S
Molecular weight225.19 g/mol
IUPAC name4-(3,3,3-trifluoropropyl)-1,3-thiazole-2-carboxylic acid
InChIKeyKTBCKZKGWCPOPH-UHFFFAOYSA-N
SMILESC1=C(N=C(S1)C(=O)O)CCC(F)(F)F

Computed by PubChem (NCBI)