cas: 836-59-9 — see every product listed under this CAS number, including other names
4-[2-(4-Bromophenoxy)ethyl]morpholine, 98%, 98% (CAS 836-59-9) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch115TL0-250mg |
| cas | 836-59-9 |
| size | 250mg |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 155.60 Pln | |
| Chemat | 1g | 314.00 Pln | |
| Chemat | 5g | 1034.00 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
4-[2-(4-bromophenoxy)ethyl]morpholine (CAS 836-59-9) is a chemical compound with the molecular formula C12H16BrNO2 and a molecular weight of 286.16 g/mol. IUPAC name: 4-[2-(4-bromophenoxy)ethyl]morpholine. InChIKey: SWXZUUKQIQPHIC-UHFFFAOYSA-N.
| Molecular formula | C12H16BrNO2 |
|---|---|
| Molecular weight | 286.16 g/mol |
| IUPAC name | 4-[2-(4-bromophenoxy)ethyl]morpholine |
| InChIKey | SWXZUUKQIQPHIC-UHFFFAOYSA-N |
| SMILES | C1COCCN1CCOC2=CC=C(C=C2)Br |
Computed by PubChem (NCBI)