cas: 35290-97-2 — see every product listed under this CAS number, including other names
4-AMINO-5-BROMO-2-METHOXYBENZOIC ACID, 98% (CAS 35290-97-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F386803-100MG |
| cas | 35290-97-2 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 372.80 Pln | |
| Fluorochem | 250mg | 607.10 Pln | |
| Fluorochem | 1g | 1518.23 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
4-amino-5-bromo-2-methoxybenzoic acid (CAS 35290-97-2) is a chemical compound with the molecular formula C8H8BrNO3 and a molecular weight of 246.06 g/mol. IUPAC name: 4-amino-5-bromo-2-methoxybenzoic acid. InChIKey: WHXLHIGUTBQVOF-UHFFFAOYSA-N.
| Molecular formula | C8H8BrNO3 |
|---|---|
| Molecular weight | 246.06 g/mol |
| IUPAC name | 4-amino-5-bromo-2-methoxybenzoic acid |
| InChIKey | WHXLHIGUTBQVOF-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C=C1C(=O)O)Br)N |
Computed by PubChem (NCBI)