cas: 5959-56-8 — see every product listed under this CAS number, including other names
4-Amino-1-naphthol hydrochloride, 98%, 98% (CAS 5959-56-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g, 50g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1144VX-100mg |
| cas | 5959-56-8 |
| size | 100mg |
| availability | 200g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 93.20 Pln | |
| Chemat | 250mg | 112.40 Pln | |
| Chemat | 1g | 165.20 Pln | |
| Chemat | 5g | 510.80 Pln | |
| Chemat | 10g | 890.00 Pln | |
| Chemat | 25g | 1782.80 Pln | |
| Chemat | 50g | 3165.20 Pln | |
| Chemat | 100g | 5574.80 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
4-aminonaphthalen-1-ol;hydrochloride (CAS 5959-56-8) is a chemical compound with the molecular formula C10H10ClNO and a molecular weight of 195.64 g/mol. IUPAC name: 4-aminonaphthalen-1-ol;hydrochloride. InChIKey: FDBQTRARWCKEJY-UHFFFAOYSA-N.
| Molecular formula | C10H10ClNO |
|---|---|
| Molecular weight | 195.64 g/mol |
| IUPAC name | 4-aminonaphthalen-1-ol;hydrochloride |
| InChIKey | FDBQTRARWCKEJY-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=CC=C2O)N.Cl |
Computed by PubChem (NCBI)