CAS 61220-51-7 appears in our catalog under these names: 5-Chlorotryptophol, 95%, 5-Chlorotryptophol 95%, 5-Chlorotryptophol, 95%, 95%, 5-Chlorotryptophol. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 10g, 5g, 250mg, 100mg.
2-(5-chloro-1H-indol-3-yl)ethanol (CAS 61220-51-7) is a chemical compound with the molecular formula C10H10ClNO and a molecular weight of 195.64 g/mol. IUPAC name: 2-(5-chloro-1H-indol-3-yl)ethanol. InChIKey: IEYZBUJHHBTQCR-UHFFFAOYSA-N.
| Molecular formula | C10H10ClNO |
|---|---|
| Molecular weight | 195.64 g/mol |
| IUPAC name | 2-(5-chloro-1H-indol-3-yl)ethanol |
| InChIKey | IEYZBUJHHBTQCR-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1Cl)C(=CN2)CCO |
Computed by PubChem (NCBI)