cas: 14916-64-4 — see every product listed under this CAS number, including other names
4-Amino-2-nitropyridine, 97%, 97% (CAS 14916-64-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch112LFF-100mg |
| cas | 14916-64-4 |
| size | 100mg |
| availability | 15g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 141.20 Pln | |
| Chemat | 250mg | 198.80 Pln | |
| Chemat | 1g | 544.40 Pln | |
| Chemat | 5g | 2147.60 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
2-nitropyridin-4-amine (CAS 14916-64-4) is a chemical compound with the molecular formula C5H5N3O2 and a molecular weight of 139.11 g/mol. IUPAC name: 2-nitropyridin-4-amine. InChIKey: ZPFUWAVLEWIOEJ-UHFFFAOYSA-N.
| Molecular formula | C5H5N3O2 |
|---|---|
| Molecular weight | 139.11 g/mol |
| IUPAC name | 2-nitropyridin-4-amine |
| InChIKey | ZPFUWAVLEWIOEJ-UHFFFAOYSA-N |
| SMILES | C1=CN=C(C=C1N)[N+](=O)[O-] |
Computed by PubChem (NCBI)