cas: 78473-00-4 — see every product listed under this CAS number, including other names
4-Amino-3,5-dichlorobenzonitrile, >98.0%(GC) (CAS 78473-00-4) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | A1928-1G |
| cas | 78473-00-4 |
| size | 1g |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 1g | 193.59 Pln | |
| TCI | 5g | 385.37 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | >98.0%(GC) |
4-amino-3,5-dichlorobenzonitrile (CAS 78473-00-4) is a chemical compound with the molecular formula C7H4Cl2N2 and a molecular weight of 187.02 g/mol. IUPAC name: 4-amino-3,5-dichlorobenzonitrile. InChIKey: COFNCCWGWXFACE-UHFFFAOYSA-N.
| Molecular formula | C7H4Cl2N2 |
|---|---|
| Molecular weight | 187.02 g/mol |
| IUPAC name | 4-amino-3,5-dichlorobenzonitrile |
| InChIKey | COFNCCWGWXFACE-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1Cl)N)Cl)C#N |
Computed by PubChem (NCBI)