cas: 2122-61-4 — see every product listed under this CAS number, including other names
4-Amino-3,5-diiodobenzoic acid, 95% (CAS 2122-61-4) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g. Offered by: AmBeed, Fluorochem.
| brand | AmBeed |
|---|---|
| catalog number | A320794-1g |
| cas | 2122-61-4 |
| size | 1g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 1g | 239.26 Pln | |
| AmBeed | 5g | 662.41 Pln | |
| Fluorochem | 25g | 1388.07 Pln | |
| Fluorochem | 5g | 440.49 Pln |
| purity | 95% |
|---|---|
| delivery time | To be confirmed by Chemat |
4-amino-3,5-diiodobenzoic acid (CAS 2122-61-4) is a chemical compound with the molecular formula C7H5I2NO2 and a molecular weight of 388.93 g/mol. IUPAC name: 4-amino-3,5-diiodobenzoic acid. InChIKey: WXTVPMWCUMEVSZ-UHFFFAOYSA-N.
| Molecular formula | C7H5I2NO2 |
|---|---|
| Molecular weight | 388.93 g/mol |
| IUPAC name | 4-amino-3,5-diiodobenzoic acid |
| InChIKey | WXTVPMWCUMEVSZ-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1I)N)I)C(=O)O |
Computed by PubChem (NCBI)