cas: 2122-61-4 — see every product listed under this CAS number, including other names
4-Amino-3,5-diiodobenzoic acid, 97%, 97% (CAS 2122-61-4) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114KP2-1g |
| cas | 2122-61-4 |
| size | 1g |
| availability | 50g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 174.80 Pln | |
| Chemat | 5g | 304.40 Pln | |
| Chemat | 10g | 501.20 Pln | |
| Chemat | 25g | 1154.00 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
4-amino-3,5-diiodobenzoic acid (CAS 2122-61-4) is a chemical compound with the molecular formula C7H5I2NO2 and a molecular weight of 388.93 g/mol. IUPAC name: 4-amino-3,5-diiodobenzoic acid. InChIKey: WXTVPMWCUMEVSZ-UHFFFAOYSA-N.
| Molecular formula | C7H5I2NO2 |
|---|---|
| Molecular weight | 388.93 g/mol |
| IUPAC name | 4-amino-3,5-diiodobenzoic acid |
| InChIKey | WXTVPMWCUMEVSZ-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1I)N)I)C(=O)O |
Computed by PubChem (NCBI)