cas: 657391-86-1 — see every product listed under this CAS number, including other names
4-Amino-8-methoxy-2-methylquinoline, ≥98%, ≥98% (CAS 657391-86-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11FGO7-100mg |
| cas | 657391-86-1 |
| size | 100mg |
| availability | 9g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 501.20 Pln | |
| Chemat | 250mg | 832.40 Pln | |
| Chemat | 1g | 2190.80 Pln |
| purity | ≥98% |
|---|---|
| delivery time | 3 weeks |
8-methoxy-2-methylquinolin-4-amine (CAS 657391-86-1) is a chemical compound with the molecular formula C11H12N2O and a molecular weight of 188.23 g/mol. IUPAC name: 8-methoxy-2-methylquinolin-4-amine. InChIKey: WFHHZADQRAEVQU-UHFFFAOYSA-N.
| Molecular formula | C11H12N2O |
|---|---|
| Molecular weight | 188.23 g/mol |
| IUPAC name | 8-methoxy-2-methylquinolin-4-amine |
| InChIKey | WFHHZADQRAEVQU-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C2C=CC=C(C2=N1)OC)N |
Computed by PubChem (NCBI)