cas: 1318242-98-6 — see every product listed under this CAS number, including other names
4-Aminothieno[3,2-d]pyrimidine-7-carboxylic acid 97% (CAS 1318242-98-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A190973-100mg |
| cas | 1318242-98-6 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 220.19 Pln | |
| Ambeed | 250mg | 409.31 Pln | |
| Ambeed | 1g | 1354.94 Pln | |
| Ambeed | 5g | 4653.50 Pln |
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A190973 |
4-aminothieno[3,2-d]pyrimidine-7-carboxylic acid (CAS 1318242-98-6) is a chemical compound with the molecular formula C7H5N3O2S and a molecular weight of 195.20 g/mol. IUPAC name: 4-aminothieno[3,2-d]pyrimidine-7-carboxylic acid. InChIKey: XHAMZTOKACCSNT-UHFFFAOYSA-N.
| Molecular formula | C7H5N3O2S |
|---|---|
| Molecular weight | 195.20 g/mol |
| IUPAC name | 4-aminothieno[3,2-d]pyrimidine-7-carboxylic acid |
| InChIKey | XHAMZTOKACCSNT-UHFFFAOYSA-N |
| SMILES | C1=C(C2=C(S1)C(=NC=N2)N)C(=O)O |
Computed by PubChem (NCBI)