cas: 655254-61-8 — see every product listed under this CAS number, including other names
4-BROMO-1-[ISOCYANO-(TOLUENE-4-SULFONYL)-METHYL]-BENZENE, 95+%, 95+% (CAS 655254-61-8) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11E9LM-250mg |
| cas | 655254-61-8 |
| size | 250mg |
| availability | 15g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 328.40 Pln | |
| Chemat | 1g | 530.00 Pln | |
| Chemat | 5g | 2210.00 Pln |
| purity | 95+% |
|---|---|
| delivery time | 3 weeks |
1-[(4-bromophenyl)-isocyanomethyl]sulfonyl-4-methylbenzene (CAS 655254-61-8) is a chemical compound with the molecular formula C15H12BrNO2S and a molecular weight of 350.2 g/mol. IUPAC name: 1-[(4-bromophenyl)-isocyanomethyl]sulfonyl-4-methylbenzene. InChIKey: AMMDZRMHSZRYRW-UHFFFAOYSA-N.
| Molecular formula | C15H12BrNO2S |
|---|---|
| Molecular weight | 350.2 g/mol |
| IUPAC name | 1-[(4-bromophenyl)-isocyanomethyl]sulfonyl-4-methylbenzene |
| InChIKey | AMMDZRMHSZRYRW-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)C(C2=CC=C(C=C2)Br)[N+]#[C-] |
Computed by PubChem (NCBI)