cas: 655254-61-8 — see every product listed under this CAS number, including other names
a-Tosyl-(4-bromobenzyl) isocyanide 95+% (CAS 655254-61-8) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A210283-250mg |
| cas | 655254-61-8 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 303.62 Pln | |
| Ambeed | 1g | 487.19 Pln | |
| Ambeed | 5g | 1966.81 Pln |
| purity | 95+% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A210283 |
1-[(4-bromophenyl)-isocyanomethyl]sulfonyl-4-methylbenzene (CAS 655254-61-8) is a chemical compound with the molecular formula C15H12BrNO2S and a molecular weight of 350.2 g/mol. IUPAC name: 1-[(4-bromophenyl)-isocyanomethyl]sulfonyl-4-methylbenzene. InChIKey: AMMDZRMHSZRYRW-UHFFFAOYSA-N.
| Molecular formula | C15H12BrNO2S |
|---|---|
| Molecular weight | 350.2 g/mol |
| IUPAC name | 1-[(4-bromophenyl)-isocyanomethyl]sulfonyl-4-methylbenzene |
| InChIKey | AMMDZRMHSZRYRW-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)C(C2=CC=C(C=C2)Br)[N+]#[C-] |
Computed by PubChem (NCBI)