cas: 1141669-59-1 — see every product listed under this CAS number, including other names
4-Benzyl-2-homomorpholinecarboxylic Acid, ≥97%, ≥97% (CAS 1141669-59-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch111APQ-100mg |
| cas | 1141669-59-1 |
| size | 100mg |
| availability | 0.75g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 1950.80 Pln | |
| Chemat | 250mg | 2286.80 Pln |
| purity | ≥97% |
|---|---|
| delivery time | 3 weeks |
4-benzyl-1,4-oxazepane-2-carboxylic acid (CAS 1141669-59-1) is a chemical compound with the molecular formula C13H17NO3 and a molecular weight of 235.28 g/mol. IUPAC name: 4-benzyl-1,4-oxazepane-2-carboxylic acid. InChIKey: QMPCKMUMSFXJQD-UHFFFAOYSA-N.
| Molecular formula | C13H17NO3 |
|---|---|
| Molecular weight | 235.28 g/mol |
| IUPAC name | 4-benzyl-1,4-oxazepane-2-carboxylic acid |
| InChIKey | QMPCKMUMSFXJQD-UHFFFAOYSA-N |
| SMILES | C1CN(CC(OC1)C(=O)O)CC2=CC=CC=C2 |
Computed by PubChem (NCBI)