cas: 478014-34-5 — see every product listed under this CAS number, including other names
4-Benzyloxy-2-fluoroaniline, HCl, 95%, 95% (CAS 478014-34-5) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11DKL2-1g |
| cas | 478014-34-5 |
| size | 1g |
| availability | 50g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 563.60 Pln | |
| Chemat | 5g | 2080.40 Pln | |
| Chemat | 10g | 3232.40 Pln | |
| Chemat | 25g | 6232.40 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
2-fluoro-4-phenylmethoxyaniline;hydrochloride (CAS 478014-34-5) is a chemical compound with the molecular formula C13H13ClFNO and a molecular weight of 253.70 g/mol. IUPAC name: 2-fluoro-4-phenylmethoxyaniline;hydrochloride. InChIKey: SOFLMQZMCLIOTE-UHFFFAOYSA-N.
| Molecular formula | C13H13ClFNO |
|---|---|
| Molecular weight | 253.70 g/mol |
| IUPAC name | 2-fluoro-4-phenylmethoxyaniline;hydrochloride |
| InChIKey | SOFLMQZMCLIOTE-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC2=CC(=C(C=C2)N)F.Cl |
Computed by PubChem (NCBI)