CAS 1002557-25-6 appears in our catalog under these names: 2-(4-Fluorophenoxy)benzylamine hydrochloride, 95%, (2-(4-Fluorophenoxy)phenyl)methanamine hydrochloride, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g, 5g.
[2-(4-fluorophenoxy)phenyl]methanamine;hydrochloride (CAS 1002557-25-6) is a chemical compound with the molecular formula C13H13ClFNO and a molecular weight of 253.70 g/mol. IUPAC name: [2-(4-fluorophenoxy)phenyl]methanamine;hydrochloride. InChIKey: YMCTUAQDJZGYLP-UHFFFAOYSA-N.
| Molecular formula | C13H13ClFNO |
|---|---|
| Molecular weight | 253.70 g/mol |
| IUPAC name | [2-(4-fluorophenoxy)phenyl]methanamine;hydrochloride |
| InChIKey | YMCTUAQDJZGYLP-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)CN)OC2=CC=C(C=C2)F.Cl |
Computed by PubChem (NCBI)