CAS 568565-86-6 appears in our catalog under these names: 4-(4-Fluorophenoxy)benzylamine hydrochloride, 97%, (4-(4-Fluorophenoxy)phenyl)methanamine hydrochloride, 95+%, 4-(4-Fluorophenoxy)benzylamine hydrochloride. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 25g, 1g, 2g.
[4-(4-fluorophenoxy)phenyl]methanamine;hydrochloride (CAS 568565-86-6) is a chemical compound with the molecular formula C13H13ClFNO and a molecular weight of 253.70 g/mol. IUPAC name: [4-(4-fluorophenoxy)phenyl]methanamine;hydrochloride. InChIKey: FSCHAOUFEVMQOV-UHFFFAOYSA-N.
| Molecular formula | C13H13ClFNO |
|---|---|
| Molecular weight | 253.70 g/mol |
| IUPAC name | [4-(4-fluorophenoxy)phenyl]methanamine;hydrochloride |
| InChIKey | FSCHAOUFEVMQOV-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1CN)OC2=CC=C(C=C2)F.Cl |
Computed by PubChem (NCBI)