cas: 132437-90-2 — see every product listed under this CAS number, including other names
4-Benzyloxy-3-methylbutyric acid, 98%, 98% (CAS 132437-90-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11919D-100mg |
| cas | 132437-90-2 |
| size | 100mg |
| availability | 0.5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 443.60 Pln | |
| Chemat | 250mg | 698.00 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
3-methyl-4-phenylmethoxybutanoic acid (CAS 132437-90-2) is a chemical compound with the molecular formula C12H16O3 and a molecular weight of 208.25 g/mol. IUPAC name: 3-methyl-4-phenylmethoxybutanoic acid. InChIKey: UGBWZCMPGYFVDL-UHFFFAOYSA-N.
| Molecular formula | C12H16O3 |
|---|---|
| Molecular weight | 208.25 g/mol |
| IUPAC name | 3-methyl-4-phenylmethoxybutanoic acid |
| InChIKey | UGBWZCMPGYFVDL-UHFFFAOYSA-N |
| SMILES | CC(CC(=O)O)COCC1=CC=CC=C1 |
Computed by PubChem (NCBI)